C23H22BrNO3S — CID 102291077
(4S,5R)-4-bromo-2-(4-methylphenyl)sulfonyl-5-phenyl-2-azaspiro[5.5]undeca-7,10-dien-9-one (PubChem CID 102291077) has the molecular formula C23H22BrNO3S and a molecular weight of 472.40 g/mol. Its IUPAC name is (4S,5R)-4-bromo-2-(4-methylphenyl)sulfonyl-5-phenyl-2-azaspiro[5.5]undeca-7,10-dien-9-one.
| Compound Name | (4S,5R)-4-bromo-2-(4-methylphenyl)sulfonyl-5-phenyl-2-azaspiro[5.5]undeca-7,10-dien-9-one |
|---|---|
| PubChem CID | 102291077 |
| Molecular Formula | C23H22BrNO3S |
| Molecular Weight | 472.40 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | (4S,5R)-4-bromo-2-(4-methylphenyl)sulfonyl-5-phenyl-2-azaspiro[5.5]undeca-7,10-dien-9-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H](Br)[C@H](c3ccccc3)C3(C=CC(=O)C=C3)C2)cc1 |
| InChI | InChI=1S/C23H22BrNO3S/c1-17-7-9-20(10-8-17)29(27,28)25-15-21(24)22(18-5-3-2-4-6-18)23(16-25)13-11-19(26)12-14-23/h2-14,21-22H,15-16H2,1H3/t21-,22+/m1/s1 |
| InChIKey | JFEUYQVJNOPOAK-YADHBBJMSA-N |
| XLogP | 4.23 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|