C19H22FNO2S — CID 71477070
(3R,5R)-3-fluoro-3-methyl-1-(4-methylphenyl)sulfonyl-5-phenylpiperidine (PubChem CID 71477070) has the molecular formula C19H22FNO2S and a molecular weight of 347.46 g/mol. Its IUPAC name is (3R,5R)-3-fluoro-3-methyl-1-(4-methylphenyl)sulfonyl-5-phenylpiperidine.
| Compound Name | (3R,5R)-3-fluoro-3-methyl-1-(4-methylphenyl)sulfonyl-5-phenylpiperidine |
|---|---|
| PubChem CID | 71477070 |
| Molecular Formula | C19H22FNO2S |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | (3R,5R)-3-fluoro-3-methyl-1-(4-methylphenyl)sulfonyl-5-phenylpiperidine |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H](c3ccccc3)C[C@@](C)(F)C2)cc1 |
| InChI | InChI=1S/C19H22FNO2S/c1-15-8-10-18(11-9-15)24(22,23)21-13-17(12-19(2,20)14-21)16-6-4-3-5-7-16/h3-11,17H,12-14H2,1-2H3/t17-,19+/m0/s1 |
| InChIKey | ZMEYJJBASBGJRH-PKOBYXMFSA-N |
| XLogP | 3.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |