C24H23NO4S — CID 102042186
methyl 2-[5-(benzenesulfonyl)-7,9-dimethyl-6H-phenanthridin-6-yl]acetate (PubChem CID 102042186) has the molecular formula C24H23NO4S and a molecular weight of 421.52 g/mol. Its IUPAC name is methyl 2-[5-(benzenesulfonyl)-7,9-dimethyl-6H-phenanthridin-6-yl]acetate.
| Compound Name | methyl 2-[5-(benzenesulfonyl)-7,9-dimethyl-6H-phenanthridin-6-yl]acetate |
|---|---|
| PubChem CID | 102042186 |
| Molecular Formula | C24H23NO4S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | methyl 2-[5-(benzenesulfonyl)-7,9-dimethyl-6H-phenanthridin-6-yl]acetate |
| SMILES | COC(=O)CC1c2c(C)cc(C)cc2-c2ccccc2N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H23NO4S/c1-16-13-17(2)24-20(14-16)19-11-7-8-12-21(19)25(22(24)15-23(26)29-3)30(27,28)18-9-5-4-6-10-18/h4-14,22H,15H2,1-3H3 |
| InChIKey | FIPMGDORVPROMK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |