C26H19N5O2S — CID 135062781
cis-(2R,4S)-4-ethenyl-2-[1-(4-methylphenyl)sulfonylindol-3-yl]cyclopentane-1,1,3,3-tetracarbonitrile (PubChem CID 135062781) has the molecular formula C26H19N5O2S and a molecular weight of 465.54 g/mol. Its IUPAC name is cis-(2R,4S)-4-ethenyl-2-[1-(4-methylphenyl)sulfonylindol-3-yl]cyclopentane-1,1,3,3-tetracarbonitrile.
| Compound Name | cis-(2R,4S)-4-ethenyl-2-[1-(4-methylphenyl)sulfonylindol-3-yl]cyclopentane-1,1,3,3-tetracarbonitrile |
|---|---|
| PubChem CID | 135062781 |
| Molecular Formula | C26H19N5O2S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | cis-(2R,4S)-4-ethenyl-2-[1-(4-methylphenyl)sulfonylindol-3-yl]cyclopentane-1,1,3,3-tetracarbonitrile |
| SMILES | C=C[C@@H]1CC(C#N)(C#N)[C@@H](c2cn(S(=O)(=O)c3ccc(C)cc3)c3ccccc23)C1(C#N)C#N |
| InChI | InChI=1S/C26H19N5O2S/c1-3-19-12-25(14-27,15-28)24(26(19,16-29)17-30)22-13-31(23-7-5-4-6-21(22)23)34(32,33)20-10-8-18(2)9-11-20/h3-11,13,19,24H,1,12H2,2H3/t19-,24-/m1/s1 |
| InChIKey | WNPGWNUOFGIUAT-NTKDMRAZSA-N |
| XLogP | 4.54 |
| TPSA | 134.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|