C21H19NO6S — CID 135028350
methyl (3S)-5-[1-(4-methylphenyl)sulfonylindol-3-yl]-2-oxooxolane-3-carboxylate (PubChem CID 135028350) has the molecular formula C21H19NO6S and a molecular weight of 413.45 g/mol. Its IUPAC name is methyl (3S)-5-[1-(4-methylphenyl)sulfonylindol-3-yl]-2-oxooxolane-3-carboxylate.
| Compound Name | methyl (3S)-5-[1-(4-methylphenyl)sulfonylindol-3-yl]-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 135028350 |
| Molecular Formula | C21H19NO6S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | methyl (3S)-5-[1-(4-methylphenyl)sulfonylindol-3-yl]-2-oxooxolane-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(c2cn(S(=O)(=O)c3ccc(C)cc3)c3ccccc23)OC1=O |
| InChI | InChI=1S/C21H19NO6S/c1-13-7-9-14(10-8-13)29(25,26)22-12-17(15-5-3-4-6-18(15)22)19-11-16(20(23)27-2)21(24)28-19/h3-10,12,16,19H,11H2,1-2H3/t16-,19?/m0/s1 |
| InChIKey | SDPPSGIBLIZTQQ-UCFFOFKASA-N |
| XLogP | 2.96 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|