C32H31N3O5S — CID 101457424
(1S,3S,7R,9R)-N-(methoxymethyl)-3-[1-(4-methylphenyl)sulfonylindol-3-yl]-8-oxa-2-azatetracyclo[7.7.0.02,7.011,16]hexadeca-4,11,13,15-tetraene-5-carboxamide (PubChem CID 101457424) has the molecular formula C32H31N3O5S and a molecular weight of 569.68 g/mol. Its IUPAC name is (1S,3S,7R,9R)-N-(methoxymethyl)-3-[1-(4-methylphenyl)sulfonylindol-3-yl]-8-oxa-2-azatetracyclo[7.7.0.02,7.011,16]hexadeca-4,11,13,15-tetraene-5-carboxamide.
| Compound Name | (1S,3S,7R,9R)-N-(methoxymethyl)-3-[1-(4-methylphenyl)sulfonylindol-3-yl]-8-oxa-2-azatetracyclo[7.7.0.02,7.011,16]hexadeca-4,11,13,15-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 101457424 |
| Molecular Formula | C32H31N3O5S |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | (1S,3S,7R,9R)-N-(methoxymethyl)-3-[1-(4-methylphenyl)sulfonylindol-3-yl]-8-oxa-2-azatetracyclo[7.7.0.02,7.011,16]hexadeca-4,11,13,15-tetraene-5-carboxamide |
| SMILES | COCNC(=O)C1=C[C@@H](c2cn(S(=O)(=O)c3ccc(C)cc3)c3ccccc23)N2[C@@H](C1)O[C@@H]1Cc3ccccc3[C@@H]12 |
| InChI | InChI=1S/C32H31N3O5S/c1-20-11-13-23(14-12-20)41(37,38)34-18-26(25-9-5-6-10-27(25)34)28-15-22(32(36)33-19-39-2)17-30-35(28)31-24-8-4-3-7-21(24)16-29(31)40-30/h3-15,18,28-31H,16-17,19H2,1-2H3,(H,33,36)/t28-,29+,30+,31-/m0/s1 |
| InChIKey | HGPNWJXLJCVKAO-KQFVITFDSA-N |
| XLogP | 4.60 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|