C17H12N4 — CID 135061972
cis-(2R,4S)-4-ethenyl-2-phenylcyclopentane-1,1,3,3-tetracarbonitrile (PubChem CID 135061972) has the molecular formula C17H12N4 and a molecular weight of 272.31 g/mol. Its IUPAC name is cis-(2R,4S)-4-ethenyl-2-phenylcyclopentane-1,1,3,3-tetracarbonitrile.
| Compound Name | cis-(2R,4S)-4-ethenyl-2-phenylcyclopentane-1,1,3,3-tetracarbonitrile |
|---|---|
| PubChem CID | 135061972 |
| Molecular Formula | C17H12N4 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | cis-(2R,4S)-4-ethenyl-2-phenylcyclopentane-1,1,3,3-tetracarbonitrile |
| SMILES | C=C[C@@H]1CC(C#N)(C#N)[C@@H](c2ccccc2)C1(C#N)C#N |
| InChI | InChI=1S/C17H12N4/c1-2-14-8-16(9-18,10-19)15(17(14,11-20)12-21)13-6-4-3-5-7-13/h2-7,14-15H,1,8H2/t14-,15-/m1/s1 |
| InChIKey | IPFFDQDJBDPGNE-HUUCEWRRSA-N |
| XLogP | 3.04 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|