C20H16N2O — CID 10851777
2-phenyl-4-[(E)-2-phenylethenyl]oxolane-3,3-dicarbonitrile (PubChem CID 10851777) has the molecular formula C20H16N2O and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-phenyl-4-[(E)-2-phenylethenyl]oxolane-3,3-dicarbonitrile.
| Compound Name | 2-phenyl-4-[(E)-2-phenylethenyl]oxolane-3,3-dicarbonitrile |
|---|---|
| PubChem CID | 10851777 |
| Molecular Formula | C20H16N2O |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-phenyl-4-[(E)-2-phenylethenyl]oxolane-3,3-dicarbonitrile |
| SMILES | N#CC1(C#N)C(/C=C/c2ccccc2)COC1c1ccccc1 |
| InChI | InChI=1S/C20H16N2O/c21-14-20(15-22)18(12-11-16-7-3-1-4-8-16)13-23-19(20)17-9-5-2-6-10-17/h1-12,18-19H,13H2/b12-11+ |
| InChIKey | KEALGWQUCZWCBB-VAWYXSNFSA-N |
| XLogP | 4.12 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |