C15H14N2 — CID 11138716
2-[(E)-2-phenylethenyl]cyclopentane-1,1-dicarbonitrile (PubChem CID 11138716) has the molecular formula C15H14N2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-[(E)-2-phenylethenyl]cyclopentane-1,1-dicarbonitrile.
| Compound Name | 2-[(E)-2-phenylethenyl]cyclopentane-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 11138716 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 2-[(E)-2-phenylethenyl]cyclopentane-1,1-dicarbonitrile |
| SMILES | N#CC1(C#N)CCCC1/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H14N2/c16-11-15(12-17)10-4-7-14(15)9-8-13-5-2-1-3-6-13/h1-3,5-6,8-9,14H,4,7,10H2/b9-8+ |
| InChIKey | REWMVPSXFIFAPX-CMDGGOBGSA-N |
| XLogP | 3.53 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |