C24H20ClN3O4S — CID 154709490
(5aR,10bR,11S)-7-chloro-11-ethenyl-6-(4-methylphenyl)sulfonyl-10b-nitro-5a,11-dihydro-5H-indolo[2,3-b]quinoline (PubChem CID 154709490) has the molecular formula C24H20ClN3O4S and a molecular weight of 481.96 g/mol. Its IUPAC name is (5aR,10bR,11S)-7-chloro-11-ethenyl-6-(4-methylphenyl)sulfonyl-10b-nitro-5a,11-dihydro-5H-indolo[2,3-b]quinoline.
| Compound Name | (5aR,10bR,11S)-7-chloro-11-ethenyl-6-(4-methylphenyl)sulfonyl-10b-nitro-5a,11-dihydro-5H-indolo[2,3-b]quinoline |
|---|---|
| PubChem CID | 154709490 |
| Molecular Formula | C24H20ClN3O4S |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | (5aR,10bR,11S)-7-chloro-11-ethenyl-6-(4-methylphenyl)sulfonyl-10b-nitro-5a,11-dihydro-5H-indolo[2,3-b]quinoline |
| SMILES | C=C[C@H]1c2ccccc2N[C@@H]2N(S(=O)(=O)c3ccc(C)cc3)c3c(Cl)cccc3[C@@]21[N+](=O)[O-] |
| InChI | InChI=1S/C24H20ClN3O4S/c1-3-18-17-7-4-5-10-21(17)26-23-24(18,28(29)30)19-8-6-9-20(25)22(19)27(23)33(31,32)16-13-11-15(2)12-14-16/h3-14,18,23,26H,1H2,2H3/t18-,23+,24+/m0/s1 |
| InChIKey | WEMQVMDZHFLRIH-NTUVXCKYSA-N |
| XLogP | 5.05 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|