C21H20N2O2S — CID 177431926
(2Z)-2-[4-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]-2-phenylacetonitrile (PubChem CID 177431926) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is (2Z)-2-[4-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]-2-phenylacetonitrile.
| Compound Name | (2Z)-2-[4-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]-2-phenylacetonitrile |
|---|---|
| PubChem CID | 177431926 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (2Z)-2-[4-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]-2-phenylacetonitrile |
| SMILES | C=CC1CN(S(=O)(=O)c2ccc(C)cc2)C/C1=C(\C#N)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O2S/c1-3-17-14-23(26(24,25)19-11-9-16(2)10-12-19)15-21(17)20(13-22)18-7-5-4-6-8-18/h3-12,17H,1,14-15H2,2H3/b21-20- |
| InChIKey | FKZBTXQQBZNZOO-MRCUWXFGSA-N |
| XLogP | 3.78 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|