C26H25NO3S — CID 155930859
(2E)-2-[(4S)-4-methyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]-1,2-diphenylethanone (PubChem CID 155930859) has the molecular formula C26H25NO3S and a molecular weight of 431.56 g/mol. Its IUPAC name is (2E)-2-[(4S)-4-methyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]-1,2-diphenylethanone.
| Compound Name | (2E)-2-[(4S)-4-methyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]-1,2-diphenylethanone |
|---|---|
| PubChem CID | 155930859 |
| Molecular Formula | C26H25NO3S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | (2E)-2-[(4S)-4-methyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]-1,2-diphenylethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C(=C(/C(=O)c3ccccc3)c3ccccc3)[C@H](C)C2)cc1 |
| InChI | InChI=1S/C26H25NO3S/c1-19-13-15-23(16-14-19)31(29,30)27-17-20(2)24(18-27)25(21-9-5-3-6-10-21)26(28)22-11-7-4-8-12-22/h3-16,20H,17-18H2,1-2H3/b25-24-/t20-/m1/s1 |
| InChIKey | BLYKXSSHXVYDKX-CPSPCKPPSA-N |
| XLogP | 4.97 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|