C31H36BNO4S — CID 139148435
(3R,4Z)-3-methyl-1-(4-methylphenyl)sulfonyl-4-[(4-phenylphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]pyrrolidine (PubChem CID 139148435) has the molecular formula C31H36BNO4S and a molecular weight of 529.51 g/mol. Its IUPAC name is (3R,4Z)-3-methyl-1-(4-methylphenyl)sulfonyl-4-[(4-phenylphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]pyrrolidine.
| Compound Name | (3R,4Z)-3-methyl-1-(4-methylphenyl)sulfonyl-4-[(4-phenylphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]pyrrolidine |
|---|---|
| PubChem CID | 139148435 |
| Molecular Formula | C31H36BNO4S |
| Molecular Weight | 529.51 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | (3R,4Z)-3-methyl-1-(4-methylphenyl)sulfonyl-4-[(4-phenylphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]pyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C(=C(/B3OC(C)(C)C(C)(C)O3)c3ccc(-c4ccccc4)cc3)[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C31H36BNO4S/c1-22-12-18-27(19-13-22)38(34,35)33-20-23(2)28(21-33)29(32-36-30(3,4)31(5,6)37-32)26-16-14-25(15-17-26)24-10-8-7-9-11-24/h7-19,23H,20-21H2,1-6H3/b29-28-/t23-/m0/s1 |
| InChIKey | RWAPOJBBAUFICE-BMJHRBPQSA-N |
| XLogP | 6.39 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.51 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|