C22H25NO2S — CID 54763073
(3Z)-3-benzylidene-1-(4-methylphenyl)sulfonyl-4-(2-methylprop-1-enyl)pyrrolidine (PubChem CID 54763073) has the molecular formula C22H25NO2S and a molecular weight of 367.51 g/mol. Its IUPAC name is (3Z)-3-benzylidene-1-(4-methylphenyl)sulfonyl-4-(2-methylprop-1-enyl)pyrrolidine.
| Compound Name | (3Z)-3-benzylidene-1-(4-methylphenyl)sulfonyl-4-(2-methylprop-1-enyl)pyrrolidine |
|---|---|
| PubChem CID | 54763073 |
| Molecular Formula | C22H25NO2S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | (3Z)-3-benzylidene-1-(4-methylphenyl)sulfonyl-4-(2-methylprop-1-enyl)pyrrolidine |
| SMILES | CC(C)=CC1CN(S(=O)(=O)c2ccc(C)cc2)C/C1=C\c1ccccc1 |
| InChI | InChI=1S/C22H25NO2S/c1-17(2)13-20-15-23(16-21(20)14-19-7-5-4-6-8-19)26(24,25)22-11-9-18(3)10-12-22/h4-14,20H,15-16H2,1-3H3/b21-14+ |
| InChIKey | UBKSOLIAJSBFHV-KGENOOAVSA-N |
| XLogP | 4.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|