C15H18ClNO2S — CID 177402362
(3E)-1-(benzenesulfonyl)-3-(1-chloropropylidene)-4-ethenylpyrrolidine (PubChem CID 177402362) has the molecular formula C15H18ClNO2S and a molecular weight of 311.83 g/mol. Its IUPAC name is (3E)-1-(benzenesulfonyl)-3-(1-chloropropylidene)-4-ethenylpyrrolidine.
| Compound Name | (3E)-1-(benzenesulfonyl)-3-(1-chloropropylidene)-4-ethenylpyrrolidine |
|---|---|
| PubChem CID | 177402362 |
| Molecular Formula | C15H18ClNO2S |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | (3E)-1-(benzenesulfonyl)-3-(1-chloropropylidene)-4-ethenylpyrrolidine |
| SMILES | C=CC1CN(S(=O)(=O)c2ccccc2)C/C1=C(/Cl)CC |
| InChI | InChI=1S/C15H18ClNO2S/c1-3-12-10-17(11-14(12)15(16)4-2)20(18,19)13-8-6-5-7-9-13/h3,5-9,12H,1,4,10-11H2,2H3/b15-14- |
| InChIKey | RNBKMGZVHNIAOL-PFONDFGASA-N |
| XLogP | 3.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|