C16H21NO2S — CID 177495414
(3R,4E)-1-(benzenesulfonyl)-3-[(E)-prop-1-enyl]-4-propylidenepyrrolidine (PubChem CID 177495414) has the molecular formula C16H21NO2S and a molecular weight of 291.42 g/mol. Its IUPAC name is (3R,4E)-1-(benzenesulfonyl)-3-[(E)-prop-1-enyl]-4-propylidenepyrrolidine.
| Compound Name | (3R,4E)-1-(benzenesulfonyl)-3-[(E)-prop-1-enyl]-4-propylidenepyrrolidine |
|---|---|
| PubChem CID | 177495414 |
| Molecular Formula | C16H21NO2S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | (3R,4E)-1-(benzenesulfonyl)-3-[(E)-prop-1-enyl]-4-propylidenepyrrolidine |
| SMILES | C/C=C/[C@H]1CN(S(=O)(=O)c2ccccc2)C/C1=C/CC |
| InChI | InChI=1S/C16H21NO2S/c1-3-8-14-12-17(13-15(14)9-4-2)20(18,19)16-10-6-5-7-11-16/h3,5-11,14H,4,12-13H2,1-2H3/b8-3+,15-9-/t14-/m0/s1 |
| InChIKey | YPSILWYUUVXALF-LRDBBJLMSA-N |
| XLogP | 3.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|