C20H23NO2S — CID 102197856
(5R)-5-ethenyl-8-methyl-3-(4-methylphenyl)sulfonyl-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 102197856) has the molecular formula C20H23NO2S and a molecular weight of 341.48 g/mol. Its IUPAC name is (5R)-5-ethenyl-8-methyl-3-(4-methylphenyl)sulfonyl-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | (5R)-5-ethenyl-8-methyl-3-(4-methylphenyl)sulfonyl-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 102197856 |
| Molecular Formula | C20H23NO2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (5R)-5-ethenyl-8-methyl-3-(4-methylphenyl)sulfonyl-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | C=C[C@H]1CN(S(=O)(=O)c2ccc(C)cc2)CCc2cc(C)ccc21 |
| InChI | InChI=1S/C20H23NO2S/c1-4-17-14-21(12-11-18-13-16(3)7-10-20(17)18)24(22,23)19-8-5-15(2)6-9-19/h4-10,13,17H,1,11-12,14H2,2-3H3/t17-/m0/s1 |
| InChIKey | QTKWZNOABOXKKY-KRWDZBQOSA-N |
| XLogP | 3.82 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|