C21H25NO2S — CID 102197851
(5S)-5-ethenyl-7,8-dimethyl-3-(4-methylphenyl)sulfonyl-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 102197851) has the molecular formula C21H25NO2S and a molecular weight of 355.50 g/mol. Its IUPAC name is (5S)-5-ethenyl-7,8-dimethyl-3-(4-methylphenyl)sulfonyl-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | (5S)-5-ethenyl-7,8-dimethyl-3-(4-methylphenyl)sulfonyl-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 102197851 |
| Molecular Formula | C21H25NO2S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (5S)-5-ethenyl-7,8-dimethyl-3-(4-methylphenyl)sulfonyl-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | C=C[C@@H]1CN(S(=O)(=O)c2ccc(C)cc2)CCc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C21H25NO2S/c1-5-18-14-22(25(23,24)20-8-6-15(2)7-9-20)11-10-19-12-16(3)17(4)13-21(18)19/h5-9,12-13,18H,1,10-11,14H2,2-4H3/t18-/m1/s1 |
| InChIKey | OCMWHFXLQMXHHO-GOSISDBHSA-N |
| XLogP | 4.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|