C14H18BrNO3S — CID 102361277
[(4E)-4-(bromomethylidene)-1-(4-methylphenyl)sulfonylpiperidin-3-yl]methanol (PubChem CID 102361277) has the molecular formula C14H18BrNO3S and a molecular weight of 360.27 g/mol. Its IUPAC name is [(4E)-4-(bromomethylidene)-1-(4-methylphenyl)sulfonylpiperidin-3-yl]methanol.
| Compound Name | [(4E)-4-(bromomethylidene)-1-(4-methylphenyl)sulfonylpiperidin-3-yl]methanol |
|---|---|
| PubChem CID | 102361277 |
| Molecular Formula | C14H18BrNO3S |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | [(4E)-4-(bromomethylidene)-1-(4-methylphenyl)sulfonylpiperidin-3-yl]methanol |
| SMILES | Cc1ccc(S(=O)(=O)N2CC/C(=C\Br)C(CO)C2)cc1 |
| InChI | InChI=1S/C14H18BrNO3S/c1-11-2-4-14(5-3-11)20(18,19)16-7-6-12(8-15)13(9-16)10-17/h2-5,8,13,17H,6-7,9-10H2,1H3/b12-8+ |
| InChIKey | TYPBNSBFPILPES-XYOKQWHBSA-N |
| XLogP | 2.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |