C22H25NO3S — CID 177422479
(3R,5E)-3-benzyl-5-ethylidene-1-(4-methylphenyl)sulfonylazepan-4-one (PubChem CID 177422479) has the molecular formula C22H25NO3S and a molecular weight of 383.51 g/mol. Its IUPAC name is (3R,5E)-3-benzyl-5-ethylidene-1-(4-methylphenyl)sulfonylazepan-4-one.
| Compound Name | (3R,5E)-3-benzyl-5-ethylidene-1-(4-methylphenyl)sulfonylazepan-4-one |
|---|---|
| PubChem CID | 177422479 |
| Molecular Formula | C22H25NO3S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (3R,5E)-3-benzyl-5-ethylidene-1-(4-methylphenyl)sulfonylazepan-4-one |
| SMILES | C/C=C1\CCN(S(=O)(=O)c2ccc(C)cc2)C[C@@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C22H25NO3S/c1-3-19-13-14-23(27(25,26)21-11-9-17(2)10-12-21)16-20(22(19)24)15-18-7-5-4-6-8-18/h3-12,20H,13-16H2,1-2H3/b19-3+/t20-/m1/s1 |
| InChIKey | NUQXEPBCWRSQQA-REDVARKWSA-N |
| XLogP | 3.76 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|