C19H20FNO2S — CID 11739461
3-[(4-fluorophenyl)methyl]-4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidine (PubChem CID 11739461) has the molecular formula C19H20FNO2S and a molecular weight of 345.44 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidine.
| Compound Name | 3-[(4-fluorophenyl)methyl]-4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 11739461 |
| Molecular Formula | C19H20FNO2S |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidine |
| SMILES | C=C1CN(S(=O)(=O)c2ccc(C)cc2)CC1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FNO2S/c1-14-3-9-19(10-4-14)24(22,23)21-12-15(2)17(13-21)11-16-5-7-18(20)8-6-16/h3-10,17H,2,11-13H2,1H3 |
| InChIKey | FJIKKEKULFXDJE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|