C17H25NO3S — CID 134866859
3-(2-ethoxypropan-2-yl)-4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidine (PubChem CID 134866859) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is 3-(2-ethoxypropan-2-yl)-4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidine.
| Compound Name | 3-(2-ethoxypropan-2-yl)-4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 134866859 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 3-(2-ethoxypropan-2-yl)-4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidine |
| SMILES | C=C1CN(S(=O)(=O)c2ccc(C)cc2)CC1C(C)(C)OCC |
| InChI | InChI=1S/C17H25NO3S/c1-6-21-17(4,5)16-12-18(11-14(16)3)22(19,20)15-9-7-13(2)8-10-15/h7-10,16H,3,6,11-12H2,1-2,4-5H3 |
| InChIKey | LLBCIWIRHHGHHX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|