C19H31NO5SSi — CID 102470760
triethoxy-[(E)-[4-methyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]methyl]silane (PubChem CID 102470760) has the molecular formula C19H31NO5SSi and a molecular weight of 413.61 g/mol. Its IUPAC name is triethoxy-[(E)-[4-methyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]methyl]silane.
| Compound Name | triethoxy-[(E)-[4-methyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]methyl]silane |
|---|---|
| PubChem CID | 102470760 |
| Molecular Formula | C19H31NO5SSi |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | triethoxy-[(E)-[4-methyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]methyl]silane |
| SMILES | CCO[Si](/C=C1/CN(S(=O)(=O)c2ccc(C)cc2)CC1C)(OCC)OCC |
| InChI | InChI=1S/C19H31NO5SSi/c1-6-23-27(24-7-2,25-8-3)15-18-14-20(13-17(18)5)26(21,22)19-11-9-16(4)10-12-19/h9-12,15,17H,6-8,13-14H2,1-5H3/b18-15- |
| InChIKey | HNWHBNHGDAGYRC-SDXDJHTJSA-N |
| XLogP | 3.15 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|