C19H29NO5SSi — CID 101268462
triethoxy-[(E)-[4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]methyl]silane (PubChem CID 101268462) has the molecular formula C19H29NO5SSi and a molecular weight of 411.60 g/mol. Its IUPAC name is triethoxy-[(E)-[4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]methyl]silane.
| Compound Name | triethoxy-[(E)-[4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]methyl]silane |
|---|---|
| PubChem CID | 101268462 |
| Molecular Formula | C19H29NO5SSi |
| Molecular Weight | 411.60 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | triethoxy-[(E)-[4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]methyl]silane |
| SMILES | C=C1CN(S(=O)(=O)c2ccc(C)cc2)C/C1=C/[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C19H29NO5SSi/c1-6-23-27(24-7-2,25-8-3)15-18-14-20(13-17(18)5)26(21,22)19-11-9-16(4)10-12-19/h9-12,15H,5-8,13-14H2,1-4H3/b18-15- |
| InChIKey | AQUIGAKYHVPXAY-SDXDJHTJSA-N |
| XLogP | 3.07 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.60 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|