C19H25NO2S — CID 11186588
(3E)-3-[(E)-hept-2-enylidene]-4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidine (PubChem CID 11186588) has the molecular formula C19H25NO2S and a molecular weight of 331.48 g/mol. Its IUPAC name is (3E)-3-[(E)-hept-2-enylidene]-4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidine.
| Compound Name | (3E)-3-[(E)-hept-2-enylidene]-4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 11186588 |
| Molecular Formula | C19H25NO2S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (3E)-3-[(E)-hept-2-enylidene]-4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidine |
| SMILES | C=C1CN(S(=O)(=O)c2ccc(C)cc2)C/C1=C/C=C/CCCC |
| InChI | InChI=1S/C19H25NO2S/c1-4-5-6-7-8-9-18-15-20(14-17(18)3)23(21,22)19-12-10-16(2)11-13-19/h7-13H,3-6,14-15H2,1-2H3/b8-7+,18-9- |
| InChIKey | PAYJNVKCPCUIHC-ZYJVETHYSA-N |
| XLogP | 4.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|