C18H25NO3S — CID 135000320
2-[4-but-1-enylidene-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]propan-2-ol (PubChem CID 135000320) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is 2-[4-but-1-enylidene-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]propan-2-ol.
| Compound Name | 2-[4-but-1-enylidene-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]propan-2-ol |
|---|---|
| PubChem CID | 135000320 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 2-[4-but-1-enylidene-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]propan-2-ol |
| SMILES | CCC=C=C1CN(S(=O)(=O)c2ccc(C)cc2)CC1C(C)(C)O |
| InChI | InChI=1S/C18H25NO3S/c1-5-6-7-15-12-19(13-17(15)18(3,4)20)23(21,22)16-10-8-14(2)9-11-16/h6,8-11,17,20H,5,12-13H2,1-4H3 |
| InChIKey | HAXKUWPBKOCJAG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |