C22H18N2O5S — CID 10432357
1-(4-methylphenyl)sulfonyl-2-(4-nitrophenyl)-2,3-dihydroquinolin-4-one (PubChem CID 10432357) has the molecular formula C22H18N2O5S and a molecular weight of 422.46 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-2-(4-nitrophenyl)-2,3-dihydroquinolin-4-one.
| Compound Name | 1-(4-methylphenyl)sulfonyl-2-(4-nitrophenyl)-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 10432357 |
| Molecular Formula | C22H18N2O5S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-2-(4-nitrophenyl)-2,3-dihydroquinolin-4-one |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccccc3C(=O)CC2c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C22H18N2O5S/c1-15-6-12-18(13-7-15)30(28,29)23-20-5-3-2-4-19(20)22(25)14-21(23)16-8-10-17(11-9-16)24(26)27/h2-13,21H,14H2,1H3 |
| InChIKey | ZHJULZZPDDCNDE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|