C23H18N2O3 — CID 134845717
3-methyl-5-(4-nitrophenyl)-6,6a-dihydro-5H-isoindolo[2,3-a]quinolin-11-one (PubChem CID 134845717) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 3-methyl-5-(4-nitrophenyl)-6,6a-dihydro-5H-isoindolo[2,3-a]quinolin-11-one.
| Compound Name | 3-methyl-5-(4-nitrophenyl)-6,6a-dihydro-5H-isoindolo[2,3-a]quinolin-11-one |
|---|---|
| PubChem CID | 134845717 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 3-methyl-5-(4-nitrophenyl)-6,6a-dihydro-5H-isoindolo[2,3-a]quinolin-11-one |
| SMILES | Cc1ccc2c(c1)C(c1ccc([N+](=O)[O-])cc1)CC1c3ccccc3C(=O)N21 |
| InChI | InChI=1S/C23H18N2O3/c1-14-6-11-21-20(12-14)19(15-7-9-16(10-8-15)25(27)28)13-22-17-4-2-3-5-18(17)23(26)24(21)22/h2-12,19,22H,13H2,1H3 |
| InChIKey | BRSPTBSHBSUSOY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|