C19H16F3NO3S — CID 102227962
[1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-2-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 102227962) has the molecular formula C19H16F3NO3S and a molecular weight of 395.40 g/mol. Its IUPAC name is [1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-2-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-2-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 102227962 |
| Molecular Formula | C19H16F3NO3S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | [1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-2-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CC=CC2C(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H16F3NO3S/c1-13-4-10-16(11-5-13)27(25,26)23-12-2-3-17(23)18(24)14-6-8-15(9-7-14)19(20,21)22/h2-11,17H,12H2,1H3 |
| InChIKey | ZFZGAEGHKBUJEH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|