C16H15F3N2O2S — CID 162400134
1-methyl-2-(4-methylphenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]diaziridine (PubChem CID 162400134) has the molecular formula C16H15F3N2O2S and a molecular weight of 356.37 g/mol. Its IUPAC name is 1-methyl-2-(4-methylphenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]diaziridine.
| Compound Name | 1-methyl-2-(4-methylphenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]diaziridine |
|---|---|
| PubChem CID | 162400134 |
| Molecular Formula | C16H15F3N2O2S |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 1-methyl-2-(4-methylphenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]diaziridine |
| SMILES | Cc1ccc(S(=O)(=O)N2C(c3ccc(C(F)(F)F)cc3)N2C)cc1 |
| InChI | InChI=1S/C16H15F3N2O2S/c1-11-3-9-14(10-4-11)24(22,23)21-15(20(21)2)12-5-7-13(8-6-12)16(17,18)19/h3-10,15H,1-2H3 |
| InChIKey | OLANTMAMEMZYEM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|