C24H20F3NO2S — CID 53356256
(1S,3R)-1-ethenyl-2-(4-methylphenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-1,3-dihydroisoindole (PubChem CID 53356256) has the molecular formula C24H20F3NO2S and a molecular weight of 443.49 g/mol. Its IUPAC name is (1S,3R)-1-ethenyl-2-(4-methylphenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-1,3-dihydroisoindole.
| Compound Name | (1S,3R)-1-ethenyl-2-(4-methylphenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 53356256 |
| Molecular Formula | C24H20F3NO2S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | (1S,3R)-1-ethenyl-2-(4-methylphenyl)sulfonyl-3-[4-(trifluoromethyl)phenyl]-1,3-dihydroisoindole |
| SMILES | C=C[C@H]1c2ccccc2[C@@H](c2ccc(C(F)(F)F)cc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H20F3NO2S/c1-3-22-20-6-4-5-7-21(20)23(17-10-12-18(13-11-17)24(25,26)27)28(22)31(29,30)19-14-8-16(2)9-15-19/h3-15,22-23H,1H2,2H3/t22-,23+/m0/s1 |
| InChIKey | KUTAUOLYQLTEGF-XZOQPEGZSA-N |
| XLogP | 6.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|