C20H18F3NO3S — CID 134934633
(1E)-1-[1-(4-methylphenyl)sulfonyl-4-[4-(trifluoromethyl)phenyl]azetidin-2-ylidene]propan-2-one (PubChem CID 134934633) has the molecular formula C20H18F3NO3S and a molecular weight of 409.43 g/mol. Its IUPAC name is (1E)-1-[1-(4-methylphenyl)sulfonyl-4-[4-(trifluoromethyl)phenyl]azetidin-2-ylidene]propan-2-one.
| Compound Name | (1E)-1-[1-(4-methylphenyl)sulfonyl-4-[4-(trifluoromethyl)phenyl]azetidin-2-ylidene]propan-2-one |
|---|---|
| PubChem CID | 134934633 |
| Molecular Formula | C20H18F3NO3S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | (1E)-1-[1-(4-methylphenyl)sulfonyl-4-[4-(trifluoromethyl)phenyl]azetidin-2-ylidene]propan-2-one |
| SMILES | CC(=O)/C=C1\CC(c2ccc(C(F)(F)F)cc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H18F3NO3S/c1-13-3-9-18(10-4-13)28(26,27)24-17(11-14(2)25)12-19(24)15-5-7-16(8-6-15)20(21,22)23/h3-11,19H,12H2,1-2H3/b17-11+ |
| InChIKey | LHRAFGDYNPNGBP-GZTJUZNOSA-N |
| XLogP | 4.62 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|