C14H15NO4S — CID 166258709
1-(4-cyclopropylphenyl)sulfonyl-2,5-dihydropyrrole-2-carboxylic acid (PubChem CID 166258709) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is 1-(4-cyclopropylphenyl)sulfonyl-2,5-dihydropyrrole-2-carboxylic acid.
| Compound Name | 1-(4-cyclopropylphenyl)sulfonyl-2,5-dihydropyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 166258709 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 1-(4-cyclopropylphenyl)sulfonyl-2,5-dihydropyrrole-2-carboxylic acid |
| SMILES | O=C(O)C1C=CCN1S(=O)(=O)c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C14H15NO4S/c16-14(17)13-2-1-9-15(13)20(18,19)12-7-5-11(6-8-12)10-3-4-10/h1-2,5-8,10,13H,3-4,9H2,(H,16,17) |
| InChIKey | YPTZKBWDFNEOJS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|