C16H21NO5S — CID 25209754
tert-butyl (2S)-1-(4-methylphenyl)sulfonyl-4-oxopyrrolidine-2-carboxylate (PubChem CID 25209754) has the molecular formula C16H21NO5S and a molecular weight of 339.41 g/mol. Its IUPAC name is tert-butyl (2S)-1-(4-methylphenyl)sulfonyl-4-oxopyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-(4-methylphenyl)sulfonyl-4-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 25209754 |
| Molecular Formula | C16H21NO5S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | tert-butyl (2S)-1-(4-methylphenyl)sulfonyl-4-oxopyrrolidine-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(=O)C[C@H]2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H21NO5S/c1-11-5-7-13(8-6-11)23(20,21)17-10-12(18)9-14(17)15(19)22-16(2,3)4/h5-8,14H,9-10H2,1-4H3/t14-/m0/s1 |
| InChIKey | SDOBIWKHMCRLLA-AWEZNQCLSA-N |
| XLogP | 1.67 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |