C22H29N3O5S2 — CID 86590458
tert-butyl 6-[4-(3-methylsulfanylpropoxy)phenyl]sulfonyl-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-7-carboxylate (PubChem CID 86590458) has the molecular formula C22H29N3O5S2 and a molecular weight of 479.62 g/mol. Its IUPAC name is tert-butyl 6-[4-(3-methylsulfanylpropoxy)phenyl]sulfonyl-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-7-carboxylate.
| Compound Name | tert-butyl 6-[4-(3-methylsulfanylpropoxy)phenyl]sulfonyl-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 86590458 |
| Molecular Formula | C22H29N3O5S2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | tert-butyl 6-[4-(3-methylsulfanylpropoxy)phenyl]sulfonyl-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-7-carboxylate |
| SMILES | CSCCCOc1ccc(S(=O)(=O)N2Cc3nccnc3CC2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H29N3O5S2/c1-22(2,3)30-21(26)20-14-18-19(24-11-10-23-18)15-25(20)32(27,28)17-8-6-16(7-9-17)29-12-5-13-31-4/h6-11,20H,5,12-15H2,1-4H3 |
| InChIKey | NIFAGYZQUKTVSY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|