C23H24N4O6S — CID 86590459
6-[4-(2-hydroxyethoxy)phenyl]sulfonyl-N-phenylmethoxy-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-7-carboxamide (PubChem CID 86590459) has the molecular formula C23H24N4O6S and a molecular weight of 484.53 g/mol. Its IUPAC name is 6-[4-(2-hydroxyethoxy)phenyl]sulfonyl-N-phenylmethoxy-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-7-carboxamide.
| Compound Name | 6-[4-(2-hydroxyethoxy)phenyl]sulfonyl-N-phenylmethoxy-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 86590459 |
| Molecular Formula | C23H24N4O6S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 6-[4-(2-hydroxyethoxy)phenyl]sulfonyl-N-phenylmethoxy-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-7-carboxamide |
| SMILES | O=C(NOCc1ccccc1)C1Cc2nccnc2CN1S(=O)(=O)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C23H24N4O6S/c28-12-13-32-18-6-8-19(9-7-18)34(30,31)27-15-21-20(24-10-11-25-21)14-22(27)23(29)26-33-16-17-4-2-1-3-5-17/h1-11,22,28H,12-16H2,(H,26,29) |
| InChIKey | ZSXJUGJLGBPMNT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 130.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|