C25H26N2O8S — CID 58866153
(2R,3R,4R,5R)-3,4,5-trihydroxy-1-(4-phenoxyphenyl)sulfonyl-N-phenylmethoxypiperidine-2-carboxamide (PubChem CID 58866153) has the molecular formula C25H26N2O8S and a molecular weight of 514.56 g/mol. Its IUPAC name is (2R,3R,4R,5R)-3,4,5-trihydroxy-1-(4-phenoxyphenyl)sulfonyl-N-phenylmethoxypiperidine-2-carboxamide.
| Compound Name | (2R,3R,4R,5R)-3,4,5-trihydroxy-1-(4-phenoxyphenyl)sulfonyl-N-phenylmethoxypiperidine-2-carboxamide |
|---|---|
| PubChem CID | 58866153 |
| Molecular Formula | C25H26N2O8S |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | (2R,3R,4R,5R)-3,4,5-trihydroxy-1-(4-phenoxyphenyl)sulfonyl-N-phenylmethoxypiperidine-2-carboxamide |
| SMILES | O=C(NOCc1ccccc1)[C@H]1[C@@H](O)[C@H](O)[C@H](O)CN1S(=O)(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C25H26N2O8S/c28-21-15-27(22(24(30)23(21)29)25(31)26-34-16-17-7-3-1-4-8-17)36(32,33)20-13-11-19(12-14-20)35-18-9-5-2-6-10-18/h1-14,21-24,28-30H,15-16H2,(H,26,31)/t21-,22-,23-,24-/m1/s1 |
| InChIKey | WPSFECRWGJEQIF-MOUTVQLLSA-N |
| XLogP | 1.18 |
| TPSA | 145.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|