C23H28N2O8S — CID 58866156
(3aS,4R,7R,7aR)-7-hydroxy-5-(4-methoxyphenyl)sulfonyl-2,2-dimethyl-N-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-4-carboxamide (PubChem CID 58866156) has the molecular formula C23H28N2O8S and a molecular weight of 492.55 g/mol. Its IUPAC name is (3aS,4R,7R,7aR)-7-hydroxy-5-(4-methoxyphenyl)sulfonyl-2,2-dimethyl-N-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-4-carboxamide.
| Compound Name | (3aS,4R,7R,7aR)-7-hydroxy-5-(4-methoxyphenyl)sulfonyl-2,2-dimethyl-N-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 58866156 |
| Molecular Formula | C23H28N2O8S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | (3aS,4R,7R,7aR)-7-hydroxy-5-(4-methoxyphenyl)sulfonyl-2,2-dimethyl-N-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-4-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2C[C@@H](O)[C@H]3OC(C)(C)O[C@H]3[C@@H]2C(=O)NOCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H28N2O8S/c1-23(2)32-20-18(26)13-25(34(28,29)17-11-9-16(30-3)10-12-17)19(21(20)33-23)22(27)24-31-14-15-7-5-4-6-8-15/h4-12,18-21,26H,13-14H2,1-3H3,(H,24,27)/t18-,19-,20-,21+/m1/s1 |
| InChIKey | WMVDNUCSMVWHEP-NCYKPQTJSA-N |
| XLogP | 1.20 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|