C26H23N5O5S — CID 154072364
N-phenylmethoxy-6-(4-pyridin-4-yloxyphenyl)sulfonyl-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-7-carboxamide (PubChem CID 154072364) has the molecular formula C26H23N5O5S and a molecular weight of 517.57 g/mol. Its IUPAC name is N-phenylmethoxy-6-(4-pyridin-4-yloxyphenyl)sulfonyl-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-7-carboxamide.
| Compound Name | N-phenylmethoxy-6-(4-pyridin-4-yloxyphenyl)sulfonyl-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 154072364 |
| Molecular Formula | C26H23N5O5S |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | N-phenylmethoxy-6-(4-pyridin-4-yloxyphenyl)sulfonyl-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-7-carboxamide |
| SMILES | O=C(NOCc1ccccc1)C1Cc2nccnc2CN1S(=O)(=O)c1ccc(Oc2ccncc2)cc1 |
| InChI | InChI=1S/C26H23N5O5S/c32-26(30-35-18-19-4-2-1-3-5-19)25-16-23-24(29-15-14-28-23)17-31(25)37(33,34)22-8-6-20(7-9-22)36-21-10-12-27-13-11-21/h1-15,25H,16-18H2,(H,30,32) |
| InChIKey | JVPSLEIOEJBMNF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|