C16H17N3O6S — CID 18345616
(3R)-N-hydroxy-4-(4-pyridin-4-yloxyphenyl)sulfonylmorpholine-3-carboxamide (PubChem CID 18345616) has the molecular formula C16H17N3O6S and a molecular weight of 379.39 g/mol. Its IUPAC name is (3R)-N-hydroxy-4-(4-pyridin-4-yloxyphenyl)sulfonylmorpholine-3-carboxamide.
| Compound Name | (3R)-N-hydroxy-4-(4-pyridin-4-yloxyphenyl)sulfonylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 18345616 |
| Molecular Formula | C16H17N3O6S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | (3R)-N-hydroxy-4-(4-pyridin-4-yloxyphenyl)sulfonylmorpholine-3-carboxamide |
| SMILES | O=C(NO)[C@H]1COCCN1S(=O)(=O)c1ccc(Oc2ccncc2)cc1 |
| InChI | InChI=1S/C16H17N3O6S/c20-16(18-21)15-11-24-10-9-19(15)26(22,23)14-3-1-12(2-4-14)25-13-5-7-17-8-6-13/h1-8,15,21H,9-11H2,(H,18,20)/t15-/m1/s1 |
| InChIKey | OMVRYWZYELUBQM-OAHLLOKOSA-N |
| XLogP | 0.77 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|