C17H18ClN3O5S — CID 18659875
(2R)-1-[4-(4-chlorophenoxy)phenyl]sulfonyl-N-hydroxypiperazine-2-carboxamide (PubChem CID 18659875) has the molecular formula C17H18ClN3O5S and a molecular weight of 411.87 g/mol. Its IUPAC name is (2R)-1-[4-(4-chlorophenoxy)phenyl]sulfonyl-N-hydroxypiperazine-2-carboxamide.
| Compound Name | (2R)-1-[4-(4-chlorophenoxy)phenyl]sulfonyl-N-hydroxypiperazine-2-carboxamide |
|---|---|
| PubChem CID | 18659875 |
| Molecular Formula | C17H18ClN3O5S |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | (2R)-1-[4-(4-chlorophenoxy)phenyl]sulfonyl-N-hydroxypiperazine-2-carboxamide |
| SMILES | O=C(NO)[C@H]1CNCCN1S(=O)(=O)c1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H18ClN3O5S/c18-12-1-3-13(4-2-12)26-14-5-7-15(8-6-14)27(24,25)21-10-9-19-11-16(21)17(22)20-23/h1-8,16,19,23H,9-11H2,(H,20,22)/t16-/m1/s1 |
| InChIKey | YQCULNLACGYFJN-MRXNPFEDSA-N |
| XLogP | 1.60 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|