C17H18FN3O4S — CID 141017724
(2R)-1-[4-(4-fluorophenyl)phenyl]sulfonyl-N-hydroxypiperazine-2-carboxamide (PubChem CID 141017724) has the molecular formula C17H18FN3O4S and a molecular weight of 379.41 g/mol. Its IUPAC name is (2R)-1-[4-(4-fluorophenyl)phenyl]sulfonyl-N-hydroxypiperazine-2-carboxamide.
| Compound Name | (2R)-1-[4-(4-fluorophenyl)phenyl]sulfonyl-N-hydroxypiperazine-2-carboxamide |
|---|---|
| PubChem CID | 141017724 |
| Molecular Formula | C17H18FN3O4S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | (2R)-1-[4-(4-fluorophenyl)phenyl]sulfonyl-N-hydroxypiperazine-2-carboxamide |
| SMILES | O=C(NO)[C@H]1CNCCN1S(=O)(=O)c1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H18FN3O4S/c18-14-5-1-12(2-6-14)13-3-7-15(8-4-13)26(24,25)21-10-9-19-11-16(21)17(22)20-23/h1-8,16,19,23H,9-11H2,(H,20,22)/t16-/m1/s1 |
| InChIKey | NGRDXOZBDDTAJW-MRXNPFEDSA-N |
| XLogP | 0.96 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|