C14H18ClN5O4S — CID 22592893
N-hydroxy-1-[4-(1H-pyrazol-5-yl)phenyl]sulfonylpiperazine-2-carboxamide;hydrochloride (PubChem CID 22592893) has the molecular formula C14H18ClN5O4S and a molecular weight of 387.85 g/mol. Its IUPAC name is N-hydroxy-1-[4-(1H-pyrazol-5-yl)phenyl]sulfonylpiperazine-2-carboxamide;hydrochloride.
| Compound Name | N-hydroxy-1-[4-(1H-pyrazol-5-yl)phenyl]sulfonylpiperazine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 22592893 |
| Molecular Formula | C14H18ClN5O4S |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | N-hydroxy-1-[4-(1H-pyrazol-5-yl)phenyl]sulfonylpiperazine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NO)C1CNCCN1S(=O)(=O)c1ccc(-c2ccn[nH]2)cc1 |
| InChI | InChI=1S/C14H17N5O4S.ClH/c20-14(18-21)13-9-15-7-8-19(13)24(22,23)11-3-1-10(2-4-11)12-5-6-16-17-12;/h1-6,13,15,21H,7-9H2,(H,16,17)(H,18,20);1H |
| InChIKey | CXDNZLHGOGJWTQ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 127.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|