C20H25N3O5S — CID 166637066
(2R)-N-[(4-methoxyphenyl)methyl]-1-(4-methoxyphenyl)sulfonylpiperazine-2-carboxamide (PubChem CID 166637066) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is (2R)-N-[(4-methoxyphenyl)methyl]-1-(4-methoxyphenyl)sulfonylpiperazine-2-carboxamide.
| Compound Name | (2R)-N-[(4-methoxyphenyl)methyl]-1-(4-methoxyphenyl)sulfonylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 166637066 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | (2R)-N-[(4-methoxyphenyl)methyl]-1-(4-methoxyphenyl)sulfonylpiperazine-2-carboxamide |
| SMILES | COc1ccc(CNC(=O)[C@H]2CNCCN2S(=O)(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H25N3O5S/c1-27-16-5-3-15(4-6-16)13-22-20(24)19-14-21-11-12-23(19)29(25,26)18-9-7-17(28-2)8-10-18/h3-10,19,21H,11-14H2,1-2H3,(H,22,24)/t19-/m1/s1 |
| InChIKey | TWSNFZCBAJHBFN-LJQANCHMSA-N |
| XLogP | 0.98 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |