C22H27N3O6S — CID 78455363
methyl 2-[[1-(benzenesulfonyl)piperazine-2-carbonyl]amino]-3-(4-methoxyphenyl)propanoate (PubChem CID 78455363) has the molecular formula C22H27N3O6S and a molecular weight of 461.54 g/mol. Its IUPAC name is methyl 2-[[1-(benzenesulfonyl)piperazine-2-carbonyl]amino]-3-(4-methoxyphenyl)propanoate.
| Compound Name | methyl 2-[[1-(benzenesulfonyl)piperazine-2-carbonyl]amino]-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 78455363 |
| Molecular Formula | C22H27N3O6S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | methyl 2-[[1-(benzenesulfonyl)piperazine-2-carbonyl]amino]-3-(4-methoxyphenyl)propanoate |
| SMILES | COC(=O)C(Cc1ccc(OC)cc1)NC(=O)C1CNCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H27N3O6S/c1-30-17-10-8-16(9-11-17)14-19(22(27)31-2)24-21(26)20-15-23-12-13-25(20)32(28,29)18-6-4-3-5-7-18/h3-11,19-20,23H,12-15H2,1-2H3,(H,24,26) |
| InChIKey | QGPZLAHODICFOR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |