C22H20FN3O4S — CID 10527121
(3R)-7-amino-2-[4-(4-fluorophenyl)phenyl]sulfonyl-N-hydroxy-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 10527121) has the molecular formula C22H20FN3O4S and a molecular weight of 441.48 g/mol. Its IUPAC name is (3R)-7-amino-2-[4-(4-fluorophenyl)phenyl]sulfonyl-N-hydroxy-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3R)-7-amino-2-[4-(4-fluorophenyl)phenyl]sulfonyl-N-hydroxy-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 10527121 |
| Molecular Formula | C22H20FN3O4S |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | (3R)-7-amino-2-[4-(4-fluorophenyl)phenyl]sulfonyl-N-hydroxy-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | Nc1ccc2c(c1)CN(S(=O)(=O)c1ccc(-c3ccc(F)cc3)cc1)[C@@H](C(=O)NO)C2 |
| InChI | InChI=1S/C22H20FN3O4S/c23-18-6-1-14(2-7-18)15-4-9-20(10-5-15)31(29,30)26-13-17-11-19(24)8-3-16(17)12-21(26)22(27)25-28/h1-11,21,28H,12-13,24H2,(H,25,27)/t21-/m1/s1 |
| InChIKey | BYJSIHNQXBCYBX-OAQYLSRUSA-N |
| XLogP | 2.70 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|