C24H25N3O4S — CID 11797863
(3R)-2-[4-[4-(dimethylamino)phenyl]phenyl]sulfonyl-N-hydroxy-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 11797863) has the molecular formula C24H25N3O4S and a molecular weight of 451.55 g/mol. Its IUPAC name is (3R)-2-[4-[4-(dimethylamino)phenyl]phenyl]sulfonyl-N-hydroxy-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3R)-2-[4-[4-(dimethylamino)phenyl]phenyl]sulfonyl-N-hydroxy-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 11797863 |
| Molecular Formula | C24H25N3O4S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | (3R)-2-[4-[4-(dimethylamino)phenyl]phenyl]sulfonyl-N-hydroxy-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CN(C)c1ccc(-c2ccc(S(=O)(=O)N3Cc4ccccc4C[C@@H]3C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C24H25N3O4S/c1-26(2)21-11-7-17(8-12-21)18-9-13-22(14-10-18)32(30,31)27-16-20-6-4-3-5-19(20)15-23(27)24(28)25-29/h3-14,23,29H,15-16H2,1-2H3,(H,25,28)/t23-/m1/s1 |
| InChIKey | FNUQESAUEFWUCJ-HSZRJFAPSA-N |
| XLogP | 3.04 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|