C20H21ClN2O6S — CID 140523364
5-[4-(4-chlorophenoxy)phenyl]sulfonyl-N-hydroxy-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine-2-carboxamide (PubChem CID 140523364) has the molecular formula C20H21ClN2O6S and a molecular weight of 452.92 g/mol. Its IUPAC name is 5-[4-(4-chlorophenoxy)phenyl]sulfonyl-N-hydroxy-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine-2-carboxamide.
| Compound Name | 5-[4-(4-chlorophenoxy)phenyl]sulfonyl-N-hydroxy-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 140523364 |
| Molecular Formula | C20H21ClN2O6S |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 5-[4-(4-chlorophenoxy)phenyl]sulfonyl-N-hydroxy-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine-2-carboxamide |
| SMILES | O=C(NO)C1CC2CN(S(=O)(=O)c3ccc(Oc4ccc(Cl)cc4)cc3)CCC2O1 |
| InChI | InChI=1S/C20H21ClN2O6S/c21-14-1-3-15(4-2-14)28-16-5-7-17(8-6-16)30(26,27)23-10-9-18-13(12-23)11-19(29-18)20(24)22-25/h1-8,13,18-19,25H,9-12H2,(H,22,24) |
| InChIKey | IVTAVVDLNCVHKF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|