C21H21F3N2O7S — CID 140516726
N-hydroxy-5-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine-2-carboxamide (PubChem CID 140516726) has the molecular formula C21H21F3N2O7S and a molecular weight of 502.47 g/mol. Its IUPAC name is N-hydroxy-5-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine-2-carboxamide.
| Compound Name | N-hydroxy-5-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 140516726 |
| Molecular Formula | C21H21F3N2O7S |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | N-hydroxy-5-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine-2-carboxamide |
| SMILES | O=C(NO)C1CC2CN(S(=O)(=O)c3ccc(Oc4ccc(OC(F)(F)F)cc4)cc3)CCC2O1 |
| InChI | InChI=1S/C21H21F3N2O7S/c22-21(23,24)33-16-3-1-14(2-4-16)31-15-5-7-17(8-6-15)34(29,30)26-10-9-18-13(12-26)11-19(32-18)20(27)25-28/h1-8,13,18-19,28H,9-12H2,(H,25,27) |
| InChIKey | ZAOVOPMKLZAXRP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|