C21H20F3NO8S — CID 69149390
[5-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-4-yl] hydrogen carbonate (PubChem CID 69149390) has the molecular formula C21H20F3NO8S and a molecular weight of 503.45 g/mol. Its IUPAC name is [5-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-4-yl] hydrogen carbonate.
| Compound Name | [5-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-4-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 69149390 |
| Molecular Formula | C21H20F3NO8S |
| Molecular Weight | 503.45 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | [5-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-4-yl] hydrogen carbonate |
| SMILES | O=C(O)OC1C2CCOC2CCN1S(=O)(=O)c1ccc(Oc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H20F3NO8S/c22-21(23,24)33-15-3-1-13(2-4-15)31-14-5-7-16(8-6-14)34(28,29)25-11-9-18-17(10-12-30-18)19(25)32-20(26)27/h1-8,17-19H,9-12H2,(H,26,27) |
| InChIKey | MNLWNADEIWBQME-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |